C13H17NO4 — CID 82087623
5-(2,4-dimethoxyphenyl)-3,5-dimethyl-1,3-oxazolidin-2-one (PubChem CID 82087623) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 5-(2,4-dimethoxyphenyl)-3,5-dimethyl-1,3-oxazolidin-2-one.
| Compound Name | 5-(2,4-dimethoxyphenyl)-3,5-dimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 82087623 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 5-(2,4-dimethoxyphenyl)-3,5-dimethyl-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(C2(C)CN(C)C(=O)O2)c(OC)c1 |
| InChI | InChI=1S/C13H17NO4/c1-13(8-14(2)12(15)18-13)10-6-5-9(16-3)7-11(10)17-4/h5-7H,8H2,1-4H3 |
| InChIKey | YICRJBIVWKTLER-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |