C11H10ClNO2S — CID 82088851
5-(5-chlorothiophen-2-yl)-1-ethylpyrrole-2-carboxylic acid (PubChem CID 82088851) has the molecular formula C11H10ClNO2S and a molecular weight of 255.73 g/mol. Its IUPAC name is 5-(5-chlorothiophen-2-yl)-1-ethylpyrrole-2-carboxylic acid.
| Compound Name | 5-(5-chlorothiophen-2-yl)-1-ethylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 82088851 |
| Molecular Formula | C11H10ClNO2S |
| Molecular Weight | 255.73 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | 5-(5-chlorothiophen-2-yl)-1-ethylpyrrole-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)ccc1-c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H10ClNO2S/c1-2-13-7(3-4-8(13)11(14)15)9-5-6-10(12)16-9/h3-6H,2H2,1H3,(H,14,15) |
| InChIKey | IYNKHMXQBMDHTC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |