C13H11ClFNO2 — CID 43671806
5-(4-chloro-2-fluorophenyl)-1-ethylpyrrole-2-carboxylic acid (PubChem CID 43671806) has the molecular formula C13H11ClFNO2 and a molecular weight of 267.69 g/mol. Its IUPAC name is 5-(4-chloro-2-fluorophenyl)-1-ethylpyrrole-2-carboxylic acid.
| Compound Name | 5-(4-chloro-2-fluorophenyl)-1-ethylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 43671806 |
| Molecular Formula | C13H11ClFNO2 |
| Molecular Weight | 267.69 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 5-(4-chloro-2-fluorophenyl)-1-ethylpyrrole-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)ccc1-c1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H11ClFNO2/c1-2-16-11(5-6-12(16)13(17)18)9-4-3-8(14)7-10(9)15/h3-7H,2H2,1H3,(H,17,18) |
| InChIKey | YQKARJACFXITHK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.69 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |