C13H8F5NO2 — CID 115564829
1-ethyl-5-(2,3,4,5,6-pentafluorophenyl)pyrrole-2-carboxylic acid (PubChem CID 115564829) has the molecular formula C13H8F5NO2 and a molecular weight of 305.20 g/mol. Its IUPAC name is 1-ethyl-5-(2,3,4,5,6-pentafluorophenyl)pyrrole-2-carboxylic acid.
| Compound Name | 1-ethyl-5-(2,3,4,5,6-pentafluorophenyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 115564829 |
| Molecular Formula | C13H8F5NO2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 1-ethyl-5-(2,3,4,5,6-pentafluorophenyl)pyrrole-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)ccc1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H8F5NO2/c1-2-19-5(3-4-6(19)13(20)21)7-8(14)10(16)12(18)11(17)9(7)15/h3-4H,2H2,1H3,(H,20,21) |
| InChIKey | ZRRGPOLUXATSAE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|