C10H10BrNO3S — CID 82094848
2-(3-bromophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one (PubChem CID 82094848) has the molecular formula C10H10BrNO3S and a molecular weight of 304.17 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one.
| Compound Name | 2-(3-bromophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 82094848 |
| Molecular Formula | C10H10BrNO3S |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 302.96 |
| IUPAC Name | 2-(3-bromophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one |
| SMILES | CC1CS(=O)(=O)N(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C10H10BrNO3S/c1-7-6-16(14,15)12(10(7)13)9-4-2-3-8(11)5-9/h2-5,7H,6H2,1H3 |
| InChIKey | MXAGDKAAFPJZGY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |