C16H22N4S — CID 82098070
4-[2-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-4-yl]aniline (PubChem CID 82098070) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 4-[2-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-4-yl]aniline.
| Compound Name | 4-[2-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 82098070 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 4-[2-[2-(4-methylpiperazin-1-yl)ethyl]-1,3-thiazol-4-yl]aniline |
| SMILES | CN1CCN(CCc2nc(-c3ccc(N)cc3)cs2)CC1 |
| InChI | InChI=1S/C16H22N4S/c1-19-8-10-20(11-9-19)7-6-16-18-15(12-21-16)13-2-4-14(17)5-3-13/h2-5,12H,6-11,17H2,1H3 |
| InChIKey | WQZDAUPXMKHBKG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|