C17H24N2O3 — CID 82098950
4-(3,4-dimethylphenyl)-4-oxo-3-(piperazin-1-ylmethyl)butanoic acid (PubChem CID 82098950) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)-4-oxo-3-(piperazin-1-ylmethyl)butanoic acid.
| Compound Name | 4-(3,4-dimethylphenyl)-4-oxo-3-(piperazin-1-ylmethyl)butanoic acid |
|---|---|
| PubChem CID | 82098950 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 4-(3,4-dimethylphenyl)-4-oxo-3-(piperazin-1-ylmethyl)butanoic acid |
| SMILES | Cc1ccc(C(=O)C(CC(=O)O)CN2CCNCC2)cc1C |
| InChI | InChI=1S/C17H24N2O3/c1-12-3-4-14(9-13(12)2)17(22)15(10-16(20)21)11-19-7-5-18-6-8-19/h3-4,9,15,18H,5-8,10-11H2,1-2H3,(H,20,21) |
| InChIKey | HTFQWLFBQFRZGJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |