C16H13NO4 — CID 82099856
6-(4-methoxyphenyl)-2-oxo-1-prop-2-ynylpyridine-3-carboxylic acid (PubChem CID 82099856) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-2-oxo-1-prop-2-ynylpyridine-3-carboxylic acid.
| Compound Name | 6-(4-methoxyphenyl)-2-oxo-1-prop-2-ynylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 82099856 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 6-(4-methoxyphenyl)-2-oxo-1-prop-2-ynylpyridine-3-carboxylic acid |
| SMILES | C#CCn1c(-c2ccc(OC)cc2)ccc(C(=O)O)c1=O |
| InChI | InChI=1S/C16H13NO4/c1-3-10-17-14(9-8-13(15(17)18)16(19)20)11-4-6-12(21-2)7-5-11/h1,4-9H,10H2,2H3,(H,19,20) |
| InChIKey | CRZBRVLRBSFION-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|