C17H24N2OS — CID 82103913
N-(3-amino-3-sulfanylidenepropyl)-N-cyclohexyl-4-methylbenzamide (PubChem CID 82103913) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-N-cyclohexyl-4-methylbenzamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-N-cyclohexyl-4-methylbenzamide |
|---|---|
| PubChem CID | 82103913 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-N-cyclohexyl-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N(CCC(N)=S)C2CCCCC2)cc1 |
| InChI | InChI=1S/C17H24N2OS/c1-13-7-9-14(10-8-13)17(20)19(12-11-16(18)21)15-5-3-2-4-6-15/h7-10,15H,2-6,11-12H2,1H3,(H2,18,21) |
| InChIKey | QKAZELMSUPOBDJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|