C15H30N2OS — CID 82104144
N-(3-amino-3-sulfanylidenepropyl)-2-methyl-N-(2,4,4-trimethylpentan-2-yl)propanamide (PubChem CID 82104144) has the molecular formula C15H30N2OS and a molecular weight of 286.49 g/mol. Its IUPAC name is N-(3-amino-3-sulfanylidenepropyl)-2-methyl-N-(2,4,4-trimethylpentan-2-yl)propanamide.
| Compound Name | N-(3-amino-3-sulfanylidenepropyl)-2-methyl-N-(2,4,4-trimethylpentan-2-yl)propanamide |
|---|---|
| PubChem CID | 82104144 |
| Molecular Formula | C15H30N2OS |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | N-(3-amino-3-sulfanylidenepropyl)-2-methyl-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| SMILES | CC(C)C(=O)N(CCC(N)=S)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C15H30N2OS/c1-11(2)13(18)17(9-8-12(16)19)15(6,7)10-14(3,4)5/h11H,8-10H2,1-7H3,(H2,16,19) |
| InChIKey | RBUKIQBJQMQZTJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|