C14H25ClN2O — CID 82102616
2-chloro-N-(2-cyanoethyl)-N-(2,4,4-trimethylpentan-2-yl)propanamide (PubChem CID 82102616) has the molecular formula C14H25ClN2O and a molecular weight of 272.82 g/mol. Its IUPAC name is 2-chloro-N-(2-cyanoethyl)-N-(2,4,4-trimethylpentan-2-yl)propanamide.
| Compound Name | 2-chloro-N-(2-cyanoethyl)-N-(2,4,4-trimethylpentan-2-yl)propanamide |
|---|---|
| PubChem CID | 82102616 |
| Molecular Formula | C14H25ClN2O |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 2-chloro-N-(2-cyanoethyl)-N-(2,4,4-trimethylpentan-2-yl)propanamide |
| SMILES | CC(Cl)C(=O)N(CCC#N)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H25ClN2O/c1-11(15)12(18)17(9-7-8-16)14(5,6)10-13(2,3)4/h11H,7,9-10H2,1-6H3 |
| InChIKey | LYMOLLFNRZLZFV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|