C12H21N3 — CID 82107787
N',N'-diethyl-2-pyridin-4-ylpropane-1,3-diamine (PubChem CID 82107787) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N',N'-diethyl-2-pyridin-4-ylpropane-1,3-diamine.
| Compound Name | N',N'-diethyl-2-pyridin-4-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 82107787 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N',N'-diethyl-2-pyridin-4-ylpropane-1,3-diamine |
| SMILES | CCN(CC)CC(CN)c1ccncc1 |
| InChI | InChI=1S/C12H21N3/c1-3-15(4-2)10-12(9-13)11-5-7-14-8-6-11/h5-8,12H,3-4,9-10,13H2,1-2H3 |
| InChIKey | KCLQYCDBTUXVST-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |