C21H25N5 — CID 123648910
1,3,5-tripyridin-4-ylhexane-1,6-diamine (PubChem CID 123648910) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is 1,3,5-tripyridin-4-ylhexane-1,6-diamine.
| Compound Name | 1,3,5-tripyridin-4-ylhexane-1,6-diamine |
|---|---|
| PubChem CID | 123648910 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1,3,5-tripyridin-4-ylhexane-1,6-diamine |
| SMILES | NCC(CC(CC(N)c1ccncc1)c1ccncc1)c1ccncc1 |
| InChI | InChI=1S/C21H25N5/c22-15-20(17-3-9-25-10-4-17)13-19(16-1-7-24-8-2-16)14-21(23)18-5-11-26-12-6-18/h1-12,19-21H,13-15,22-23H2 |
| InChIKey | NJYSXEJGCZECFU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |