C13H21N3 — CID 117246505
N'-cyclopentyl-2-pyridin-4-ylpropane-1,3-diamine (PubChem CID 117246505) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N'-cyclopentyl-2-pyridin-4-ylpropane-1,3-diamine.
| Compound Name | N'-cyclopentyl-2-pyridin-4-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 117246505 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N'-cyclopentyl-2-pyridin-4-ylpropane-1,3-diamine |
| SMILES | NCC(CNC1CCCC1)c1ccncc1 |
| InChI | InChI=1S/C13H21N3/c14-9-12(11-5-7-15-8-6-11)10-16-13-3-1-2-4-13/h5-8,12-13,16H,1-4,9-10,14H2 |
| InChIKey | NNFWXKLNQYROJO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |