C13H20N2O — CID 117242834
3-[1-amino-3-(cyclobutylamino)propan-2-yl]phenol (PubChem CID 117242834) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-[1-amino-3-(cyclobutylamino)propan-2-yl]phenol.
| Compound Name | 3-[1-amino-3-(cyclobutylamino)propan-2-yl]phenol |
|---|---|
| PubChem CID | 117242834 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-[1-amino-3-(cyclobutylamino)propan-2-yl]phenol |
| SMILES | NCC(CNC1CCC1)c1cccc(O)c1 |
| InChI | InChI=1S/C13H20N2O/c14-8-11(9-15-12-4-2-5-12)10-3-1-6-13(16)7-10/h1,3,6-7,11-12,15-16H,2,4-5,8-9,14H2 |
| InChIKey | GVOJHTCDVBZSOK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |