C14H20ClNO2 — CID 82109933
3-chloro-2,2-dimethyl-N-[2-(4-methylphenoxy)ethyl]propanamide (PubChem CID 82109933) has the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[2-(4-methylphenoxy)ethyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[2-(4-methylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 82109933 |
| Molecular Formula | C14H20ClNO2 |
| Molecular Weight | 269.77 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[2-(4-methylphenoxy)ethyl]propanamide |
| SMILES | Cc1ccc(OCCNC(=O)C(C)(C)CCl)cc1 |
| InChI | InChI=1S/C14H20ClNO2/c1-11-4-6-12(7-5-11)18-9-8-16-13(17)14(2,3)10-15/h4-7H,8-10H2,1-3H3,(H,16,17) |
| InChIKey | PJNPPANLCGETMT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.77 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|