C10H10ClN3O2S — CID 82109936
4-(chloromethyl)-5-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide (PubChem CID 82109936) has the molecular formula C10H10ClN3O2S and a molecular weight of 271.73 g/mol. Its IUPAC name is 4-(chloromethyl)-5-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide.
| Compound Name | 4-(chloromethyl)-5-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 82109936 |
| Molecular Formula | C10H10ClN3O2S |
| Molecular Weight | 271.73 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 4-(chloromethyl)-5-methyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)furan-2-carboxamide |
| SMILES | Cc1nnc(NC(=O)c2cc(CCl)c(C)o2)s1 |
| InChI | InChI=1S/C10H10ClN3O2S/c1-5-7(4-11)3-8(16-5)9(15)12-10-14-13-6(2)17-10/h3H,4H2,1-2H3,(H,12,14,15) |
| InChIKey | SIVOGCKSQJMABW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.73 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|