C10H11ClN2O2S — CID 82108782
4-(chloromethyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)-5-methylfuran-2-carboxamide (PubChem CID 82108782) has the molecular formula C10H11ClN2O2S and a molecular weight of 258.73 g/mol. Its IUPAC name is 4-(chloromethyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)-5-methylfuran-2-carboxamide.
| Compound Name | 4-(chloromethyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 82108782 |
| Molecular Formula | C10H11ClN2O2S |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | 4-(chloromethyl)-N-(4,5-dihydro-1,3-thiazol-2-yl)-5-methylfuran-2-carboxamide |
| SMILES | Cc1oc(C(=O)NC2=NCCS2)cc1CCl |
| InChI | InChI=1S/C10H11ClN2O2S/c1-6-7(5-11)4-8(15-6)9(14)13-10-12-2-3-16-10/h4H,2-3,5H2,1H3,(H,12,13,14) |
| InChIKey | ZBFYEBDDBBNLMD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|