C12H18ClNO2 — CID 82110423
3-chloro-N-[2-(furan-2-yl)propan-2-yl]-2,2-dimethylpropanamide (PubChem CID 82110423) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is 3-chloro-N-[2-(furan-2-yl)propan-2-yl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[2-(furan-2-yl)propan-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 82110423 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-chloro-N-[2-(furan-2-yl)propan-2-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CCl)C(=O)NC(C)(C)c1ccco1 |
| InChI | InChI=1S/C12H18ClNO2/c1-11(2,8-13)10(15)14-12(3,4)9-6-5-7-16-9/h5-7H,8H2,1-4H3,(H,14,15) |
| InChIKey | VYOFBTDYMGDBEP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|