C9H18ClNO2 — CID 18185421
3-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-2,2-dimethylpropanamide (PubChem CID 18185421) has the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. Its IUPAC name is 3-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18185421 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-chloro-N-(1-hydroxy-2-methylpropan-2-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(CO)NC(=O)C(C)(C)CCl |
| InChI | InChI=1S/C9H18ClNO2/c1-8(2,5-10)7(13)11-9(3,4)6-12/h12H,5-6H2,1-4H3,(H,11,13) |
| InChIKey | FQFBMDUBIQSECL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|