C8H15ClN2O3 — CID 108514050
N-(2-chloroethyl)-N'-(1-hydroxy-2-methylpropan-2-yl)oxamide (PubChem CID 108514050) has the molecular formula C8H15ClN2O3 and a molecular weight of 222.67 g/mol. Its IUPAC name is N-(2-chloroethyl)-N'-(1-hydroxy-2-methylpropan-2-yl)oxamide.
| Compound Name | N-(2-chloroethyl)-N'-(1-hydroxy-2-methylpropan-2-yl)oxamide |
|---|---|
| PubChem CID | 108514050 |
| Molecular Formula | C8H15ClN2O3 |
| Molecular Weight | 222.67 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | N-(2-chloroethyl)-N'-(1-hydroxy-2-methylpropan-2-yl)oxamide |
| SMILES | CC(C)(CO)NC(=O)C(=O)NCCCl |
| InChI | InChI=1S/C8H15ClN2O3/c1-8(2,5-12)11-7(14)6(13)10-4-3-9/h12H,3-5H2,1-2H3,(H,10,13)(H,11,14) |
| InChIKey | ZPKUUZFPPMNOOI-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.67 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|