C13H17NO — CID 82112600
3-ethyl-6,7-dimethyl-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82112600) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-ethyl-6,7-dimethyl-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 3-ethyl-6,7-dimethyl-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82112600 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 3-ethyl-6,7-dimethyl-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCC1Cc2cc(C)c(C)cc2NC1=O |
| InChI | InChI=1S/C13H17NO/c1-4-10-7-11-5-8(2)9(3)6-12(11)14-13(10)15/h5-6,10H,4,7H2,1-3H3,(H,14,15) |
| InChIKey | OAHKORFZTLGUHZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |