C9H11N3OS — CID 82113206
N-(2-amino-1-pyridin-4-yl-2-sulfanylideneethyl)acetamide (PubChem CID 82113206) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is N-(2-amino-1-pyridin-4-yl-2-sulfanylideneethyl)acetamide.
| Compound Name | N-(2-amino-1-pyridin-4-yl-2-sulfanylideneethyl)acetamide |
|---|---|
| PubChem CID | 82113206 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | N-(2-amino-1-pyridin-4-yl-2-sulfanylideneethyl)acetamide |
| SMILES | CC(=O)NC(C(N)=S)c1ccncc1 |
| InChI | InChI=1S/C9H11N3OS/c1-6(13)12-8(9(10)14)7-2-4-11-5-3-7/h2-5,8H,1H3,(H2,10,14)(H,12,13) |
| InChIKey | CGCRAUWINRAYFX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|