C9H10N4O2S — CID 92864050
N-[(2R)-1,3-diamino-1-oxo-3-sulfanylidenepropan-2-yl]pyridine-4-carboxamide (PubChem CID 92864050) has the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. Its IUPAC name is N-[(2R)-1,3-diamino-1-oxo-3-sulfanylidenepropan-2-yl]pyridine-4-carboxamide.
| Compound Name | N-[(2R)-1,3-diamino-1-oxo-3-sulfanylidenepropan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 92864050 |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | N-[(2R)-1,3-diamino-1-oxo-3-sulfanylidenepropan-2-yl]pyridine-4-carboxamide |
| SMILES | NC(=O)[C@@H](NC(=O)c1ccncc1)C(N)=S |
| InChI | InChI=1S/C9H10N4O2S/c10-7(14)6(8(11)16)13-9(15)5-1-3-12-4-2-5/h1-4,6H,(H2,10,14)(H2,11,16)(H,13,15)/t6-/m1/s1 |
| InChIKey | ZCGGNTBIIBRGNE-ZCFIWIBFSA-N |
| XLogP | -1.05 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|