C13H17N3 — CID 82113707
5-methyl-3-(2,4,6-trimethylphenyl)-1H-pyrazol-4-amine (PubChem CID 82113707) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 5-methyl-3-(2,4,6-trimethylphenyl)-1H-pyrazol-4-amine.
| Compound Name | 5-methyl-3-(2,4,6-trimethylphenyl)-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 82113707 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 5-methyl-3-(2,4,6-trimethylphenyl)-1H-pyrazol-4-amine |
| SMILES | Cc1cc(C)c(-c2n[nH]c(C)c2N)c(C)c1 |
| InChI | InChI=1S/C13H17N3/c1-7-5-8(2)11(9(3)6-7)13-12(14)10(4)15-16-13/h5-6H,14H2,1-4H3,(H,15,16) |
| InChIKey | KPTDHHSIALEDTE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |