C14H19N3 — CID 82115548
2-[4-(2,5-dimethylphenyl)piperazin-1-yl]acetonitrile (PubChem CID 82115548) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 82115548 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]acetonitrile |
| SMILES | Cc1ccc(C)c(N2CCN(CC#N)CC2)c1 |
| InChI | InChI=1S/C14H19N3/c1-12-3-4-13(2)14(11-12)17-9-7-16(6-5-15)8-10-17/h3-4,11H,6-10H2,1-2H3 |
| InChIKey | DXTQPBDJLUMXSC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|