C18H29N3O — CID 1439313
2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N,N-diethylacetamide (PubChem CID 1439313) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 1439313 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 2-[4-(2,5-dimethylphenyl)piperazin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(c2cc(C)ccc2C)CC1 |
| InChI | InChI=1S/C18H29N3O/c1-5-20(6-2)18(22)14-19-9-11-21(12-10-19)17-13-15(3)7-8-16(17)4/h7-8,13H,5-6,9-12,14H2,1-4H3 |
| InChIKey | UCQVJTMSYVDYGG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |