C12H17N3O2 — CID 82116600
N'-(2-amino-3-methylbutanoyl)benzohydrazide (PubChem CID 82116600) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is N'-(2-amino-3-methylbutanoyl)benzohydrazide.
| Compound Name | N'-(2-amino-3-methylbutanoyl)benzohydrazide |
|---|---|
| PubChem CID | 82116600 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | N'-(2-amino-3-methylbutanoyl)benzohydrazide |
| SMILES | CC(C)C(N)C(=O)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H17N3O2/c1-8(2)10(13)12(17)15-14-11(16)9-6-4-3-5-7-9/h3-8,10H,13H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | MFCVQNFAKLOYML-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|