C15H17NO2 — CID 82117881
N-cyclopropyl-2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide (PubChem CID 82117881) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-cyclopropyl-2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide.
| Compound Name | N-cyclopropyl-2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 82117881 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N-cyclopropyl-2-oxo-2-(5,6,7,8-tetrahydronaphthalen-2-yl)acetamide |
| SMILES | O=C(NC1CC1)C(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C15H17NO2/c17-14(15(18)16-13-7-8-13)12-6-5-10-3-1-2-4-11(10)9-12/h5-6,9,13H,1-4,7-8H2,(H,16,18) |
| InChIKey | LXIGHMASQWYHJT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|