C10H10N4 — CID 821189
5,6-diethylpyrazine-2,3-dicarbonitrile (PubChem CID 821189) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 5,6-diethylpyrazine-2,3-dicarbonitrile.
| Compound Name | 5,6-diethylpyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 821189 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 5,6-diethylpyrazine-2,3-dicarbonitrile |
| SMILES | CCc1nc(C#N)c(C#N)nc1CC |
| InChI | InChI=1S/C10H10N4/c1-3-7-8(4-2)14-10(6-12)9(5-11)13-7/h3-4H2,1-2H3 |
| InChIKey | DYXQCJGRWYUNKK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |