C16H18FNO — CID 82121199
1-(3,4-dimethylphenyl)-2-(2-fluoroanilino)ethanol (PubChem CID 82121199) has the molecular formula C16H18FNO and a molecular weight of 259.32 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-(2-fluoroanilino)ethanol.
| Compound Name | 1-(3,4-dimethylphenyl)-2-(2-fluoroanilino)ethanol |
|---|---|
| PubChem CID | 82121199 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-(2-fluoroanilino)ethanol |
| SMILES | Cc1ccc(C(O)CNc2ccccc2F)cc1C |
| InChI | InChI=1S/C16H18FNO/c1-11-7-8-13(9-12(11)2)16(19)10-18-15-6-4-3-5-14(15)17/h3-9,16,18-19H,10H2,1-2H3 |
| InChIKey | WHZCZUHPTWFNAM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |