C14H11BrN2O — CID 82124754
1-(3-bromophenyl)-4,5-dimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 82124754) has the molecular formula C14H11BrN2O and a molecular weight of 303.16 g/mol. Its IUPAC name is 1-(3-bromophenyl)-4,5-dimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-(3-bromophenyl)-4,5-dimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 82124754 |
| Molecular Formula | C14H11BrN2O |
| Molecular Weight | 303.16 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 1-(3-bromophenyl)-4,5-dimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1cn(-c2cccc(Br)c2)c(=O)c(C#N)c1C |
| InChI | InChI=1S/C14H11BrN2O/c1-9-8-17(12-5-3-4-11(15)6-12)14(18)13(7-16)10(9)2/h3-6,8H,1-2H3 |
| InChIKey | GQKJISANDXNLIU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |