About 2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid
2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid (PubChem CID 82125302) has the molecular formula C9H11NO3
and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid.
Analyze 2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid?
The IUPAC name of 2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid (CID 82125302) is 2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid.
What is the SMILES notation for 2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid?
The canonical SMILES for 2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid is Cc1nc(C2CC2)oc1CC(=O)O.
What is the InChIKey of 2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid?
The InChIKey is NBCMILRAHMPZOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3/c1-5-7(4-8(11)12)13-9(10-5)6-2-3-6/h6H,2-4H2,1H3,(H,11,12).
What are the key properties of 2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid?
2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid has a molecular weight of 181.19 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-cyclopropyl-4-methyl-1,3-oxazol-5-yl)acetic acid is sourced from PubChem (CID 82125302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).