C8H11N3S — CID 82125319
2-(1-propylimidazol-2-yl)sulfanylacetonitrile (PubChem CID 82125319) has the molecular formula C8H11N3S and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-(1-propylimidazol-2-yl)sulfanylacetonitrile.
| Compound Name | 2-(1-propylimidazol-2-yl)sulfanylacetonitrile |
|---|---|
| PubChem CID | 82125319 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-(1-propylimidazol-2-yl)sulfanylacetonitrile |
| SMILES | CCCn1ccnc1SCC#N |
| InChI | InChI=1S/C8H11N3S/c1-2-5-11-6-4-10-8(11)12-7-3-9/h4,6H,2,5,7H2,1H3 |
| InChIKey | BZHDNRZHHGKUOU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |