C13H15NO — CID 82125999
4-(4-tert-butylphenyl)-1,3-oxazole (PubChem CID 82125999) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-1,3-oxazole.
| Compound Name | 4-(4-tert-butylphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 82125999 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 4-(4-tert-butylphenyl)-1,3-oxazole |
| SMILES | CC(C)(C)c1ccc(-c2cocn2)cc1 |
| InChI | InChI=1S/C13H15NO/c1-13(2,3)11-6-4-10(5-7-11)12-8-15-9-14-12/h4-9H,1-3H3 |
| InChIKey | YRLSPHILWZIBNS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |