C10H10N4O2 — CID 82127283
3-phenyl-3-(2H-tetrazol-5-yl)propanoic acid (PubChem CID 82127283) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 3-phenyl-3-(2H-tetrazol-5-yl)propanoic acid.
| Compound Name | 3-phenyl-3-(2H-tetrazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 82127283 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 3-phenyl-3-(2H-tetrazol-5-yl)propanoic acid |
| SMILES | O=C(O)CC(c1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C10H10N4O2/c15-9(16)6-8(10-11-13-14-12-10)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,15,16)(H,11,12,13,14) |
| InChIKey | UOQWIAIQEXKPAN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |