C14H11ClN6O — CID 126816197
5-chloro-N-[phenyl(2H-tetrazol-5-yl)methyl]pyridine-2-carboxamide (PubChem CID 126816197) has the molecular formula C14H11ClN6O and a molecular weight of 314.74 g/mol. Its IUPAC name is 5-chloro-N-[phenyl(2H-tetrazol-5-yl)methyl]pyridine-2-carboxamide.
| Compound Name | 5-chloro-N-[phenyl(2H-tetrazol-5-yl)methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 126816197 |
| Molecular Formula | C14H11ClN6O |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 5-chloro-N-[phenyl(2H-tetrazol-5-yl)methyl]pyridine-2-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1nn[nH]n1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C14H11ClN6O/c15-10-6-7-11(16-8-10)14(22)17-12(13-18-20-21-19-13)9-4-2-1-3-5-9/h1-8,12H,(H,17,22)(H,18,19,20,21) |
| InChIKey | WTDNLUNCSPINLX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |