C16H12ClF3N6O — CID 154801311
2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N-[phenyl(2H-tetrazol-5-yl)methyl]acetamide (PubChem CID 154801311) has the molecular formula C16H12ClF3N6O and a molecular weight of 396.76 g/mol. Its IUPAC name is 2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N-[phenyl(2H-tetrazol-5-yl)methyl]acetamide.
| Compound Name | 2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N-[phenyl(2H-tetrazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 154801311 |
| Molecular Formula | C16H12ClF3N6O |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 2-[6-chloro-4-(trifluoromethyl)-2-pyridinyl]-N-[phenyl(2H-tetrazol-5-yl)methyl]acetamide |
| SMILES | O=C(Cc1cc(C(F)(F)F)cc(Cl)n1)NC(c1ccccc1)c1nn[nH]n1 |
| InChI | InChI=1S/C16H12ClF3N6O/c17-12-7-10(16(18,19)20)6-11(21-12)8-13(27)22-14(15-23-25-26-24-15)9-4-2-1-3-5-9/h1-7,14H,8H2,(H,22,27)(H,23,24,25,26) |
| InChIKey | BZXOHCABZBLQRB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|