C14H13ClFN5O — CID 167847204
(3E)-N-[(4-chloro-3-fluorophenyl)-(2H-tetrazol-5-yl)methyl]hexa-3,5-dienamide (PubChem CID 167847204) has the molecular formula C14H13ClFN5O and a molecular weight of 321.74 g/mol. Its IUPAC name is (3E)-N-[(4-chloro-3-fluorophenyl)-(2H-tetrazol-5-yl)methyl]hexa-3,5-dienamide.
| Compound Name | (3E)-N-[(4-chloro-3-fluorophenyl)-(2H-tetrazol-5-yl)methyl]hexa-3,5-dienamide |
|---|---|
| PubChem CID | 167847204 |
| Molecular Formula | C14H13ClFN5O |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | (3E)-N-[(4-chloro-3-fluorophenyl)-(2H-tetrazol-5-yl)methyl]hexa-3,5-dienamide |
| SMILES | C=C/C=C/CC(=O)NC(c1ccc(Cl)c(F)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C14H13ClFN5O/c1-2-3-4-5-12(22)17-13(14-18-20-21-19-14)9-6-7-10(15)11(16)8-9/h2-4,6-8,13H,1,5H2,(H,17,22)(H,18,19,20,21)/b4-3+ |
| InChIKey | FJJCZWSLZWHIEB-ONEGZZNKSA-N |
| XLogP | 2.33 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|