C10H9BrClN5O — CID 60912142
5-bromo-2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide (PubChem CID 60912142) has the molecular formula C10H9BrClN5O and a molecular weight of 330.57 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 60912142 |
| Molecular Formula | C10H9BrClN5O |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 5-bromo-2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cc(Br)ccc1Cl)c1nn[nH]n1 |
| InChI | InChI=1S/C10H9BrClN5O/c1-5(9-14-16-17-15-9)13-10(18)7-4-6(11)2-3-8(7)12/h2-5H,1H3,(H,13,18)(H,14,15,16,17) |
| InChIKey | YEEYRTLNWFKJHU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |