C10H11ClN6O — CID 112575806
3-amino-2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide (PubChem CID 112575806) has the molecular formula C10H11ClN6O and a molecular weight of 266.69 g/mol. Its IUPAC name is 3-amino-2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide.
| Compound Name | 3-amino-2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 112575806 |
| Molecular Formula | C10H11ClN6O |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-amino-2-chloro-N-[1-(2H-tetrazol-5-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cccc(N)c1Cl)c1nn[nH]n1 |
| InChI | InChI=1S/C10H11ClN6O/c1-5(9-14-16-17-15-9)13-10(18)6-3-2-4-7(12)8(6)11/h2-5H,12H2,1H3,(H,13,18)(H,14,15,16,17) |
| InChIKey | DCAOPUQQTAFODN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|