C9H8Cl2N6O — CID 114918317
2,5-dichloro-N-[1-(2H-tetrazol-5-yl)ethyl]pyridine-4-carboxamide (PubChem CID 114918317) has the molecular formula C9H8Cl2N6O and a molecular weight of 287.11 g/mol. Its IUPAC name is 2,5-dichloro-N-[1-(2H-tetrazol-5-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 2,5-dichloro-N-[1-(2H-tetrazol-5-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114918317 |
| Molecular Formula | C9H8Cl2N6O |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2,5-dichloro-N-[1-(2H-tetrazol-5-yl)ethyl]pyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(Cl)ncc1Cl)c1nn[nH]n1 |
| InChI | InChI=1S/C9H8Cl2N6O/c1-4(8-14-16-17-15-8)13-9(18)5-2-7(11)12-3-6(5)10/h2-4H,1H3,(H,13,18)(H,14,15,16,17) |
| InChIKey | LKMYALZWRVSVSI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|