C18H18ClFN6OS — CID 166219275
(E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-[(4-chloro-3-fluorophenyl)-(2H-tetrazol-5-yl)methyl]prop-2-enamide (PubChem CID 166219275) has the molecular formula C18H18ClFN6OS and a molecular weight of 420.90 g/mol. Its IUPAC name is (E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-[(4-chloro-3-fluorophenyl)-(2H-tetrazol-5-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-[(4-chloro-3-fluorophenyl)-(2H-tetrazol-5-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166219275 |
| Molecular Formula | C18H18ClFN6OS |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-[(4-chloro-3-fluorophenyl)-(2H-tetrazol-5-yl)methyl]prop-2-enamide |
| SMILES | CC(C)(C)c1ncc(/C=C/C(=O)NC(c2ccc(Cl)c(F)c2)c2nn[nH]n2)s1 |
| InChI | InChI=1S/C18H18ClFN6OS/c1-18(2,3)17-21-9-11(28-17)5-7-14(27)22-15(16-23-25-26-24-16)10-4-6-12(19)13(20)8-10/h4-9,15H,1-3H3,(H,22,27)(H,23,24,25,26)/b7-5+ |
| InChIKey | HPPARNHHTZDQBP-FNORWQNLSA-N |
| XLogP | 3.67 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|