C14H19F3N2O2S — CID 91943027
3-(2-tert-butyl-1,3-thiazol-5-yl)-N-(4,4,4-trifluoro-3-hydroxybutyl)prop-2-enamide (PubChem CID 91943027) has the molecular formula C14H19F3N2O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 3-(2-tert-butyl-1,3-thiazol-5-yl)-N-(4,4,4-trifluoro-3-hydroxybutyl)prop-2-enamide.
| Compound Name | 3-(2-tert-butyl-1,3-thiazol-5-yl)-N-(4,4,4-trifluoro-3-hydroxybutyl)prop-2-enamide |
|---|---|
| PubChem CID | 91943027 |
| Molecular Formula | C14H19F3N2O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 3-(2-tert-butyl-1,3-thiazol-5-yl)-N-(4,4,4-trifluoro-3-hydroxybutyl)prop-2-enamide |
| SMILES | CC(C)(C)c1ncc(C=CC(=O)NCCC(O)C(F)(F)F)s1 |
| InChI | InChI=1S/C14H19F3N2O2S/c1-13(2,3)12-19-8-9(22-12)4-5-11(21)18-7-6-10(20)14(15,16)17/h4-5,8,10,20H,6-7H2,1-3H3,(H,18,21) |
| InChIKey | CAGUIKXCBYUVNR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|