C15H17N3O3S2 — CID 91643667
(E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-pyridin-3-ylsulfonylprop-2-enamide (PubChem CID 91643667) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-pyridin-3-ylsulfonylprop-2-enamide.
| Compound Name | (E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-pyridin-3-ylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 91643667 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | (E)-3-(2-tert-butyl-1,3-thiazol-5-yl)-N-pyridin-3-ylsulfonylprop-2-enamide |
| SMILES | CC(C)(C)c1ncc(/C=C/C(=O)NS(=O)(=O)c2cccnc2)s1 |
| InChI | InChI=1S/C15H17N3O3S2/c1-15(2,3)14-17-9-11(22-14)6-7-13(19)18-23(20,21)12-5-4-8-16-10-12/h4-10H,1-3H3,(H,18,19)/b7-6+ |
| InChIKey | DSSCCYLJIFXMDB-VOTSOKGWSA-N |
| XLogP | 2.35 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|