About methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate
methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate (PubChem CID 75407250) has the molecular formula C17H18N2O3S
and a molecular weight of 330.41 g/mol. Its IUPAC name is methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate |
| PubChem CID | 75407250 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCNC(=O)/C=C/c2cnc(C)s2)cc1 |
| InChI | InChI=1S/C17H18N2O3S/c1-12-19-11-15(23-12)7-8-16(20)18-10-9-13-3-5-14(6-4-13)17(21)22-2/h3-8,11H,9-10H2,1-2H3,(H,18,20)/b8-7+ |
| InChIKey | KMKUFIYPJDUQSH-BQYQJAHWSA-N |
| XLogP | 2.61 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate?
The IUPAC name of methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate (CID 75407250) is methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate.
What is the SMILES notation for methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate?
The canonical SMILES for methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate is COC(=O)c1ccc(CCNC(=O)/C=C/c2cnc(C)s2)cc1.
What is the InChIKey of methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate?
The InChIKey is KMKUFIYPJDUQSH-BQYQJAHWSA-N. The full InChI is InChI=1S/C17H18N2O3S/c1-12-19-11-15(23-12)7-8-16(20)18-10-9-13-3-5-14(6-4-13)17(21)22-2/h3-8,11H,9-10H2,1-2H3,(H,18,20)/b8-7+.
What are the key properties of methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate?
methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate has a molecular weight of 330.41 g/mol, XLogP of 2.61, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]ethyl]benzoate is sourced from PubChem (CID 75407250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).