About methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate
methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate (PubChem CID 75407267) has the molecular formula C18H20N2O3S
and a molecular weight of 344.44 g/mol. Its IUPAC name is methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate.
Molecular Properties
| Compound Name | methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate |
| PubChem CID | 75407267 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate |
| SMILES | COC(=O)CCC(NC(=O)/C=C/c1cnc(C)s1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-13-19-12-15(24-13)8-10-17(21)20-16(9-11-18(22)23-2)14-6-4-3-5-7-14/h3-8,10,12,16H,9,11H2,1-2H3,(H,20,21)/b10-8+ |
| InChIKey | SIYFUXJRENYEAB-CSKARUKUSA-N |
| XLogP | 3.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate?
The IUPAC name of methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate (CID 75407267) is methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate.
What is the SMILES notation for methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate?
The canonical SMILES for methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate is COC(=O)CCC(NC(=O)/C=C/c1cnc(C)s1)c1ccccc1.
What is the InChIKey of methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate?
The InChIKey is SIYFUXJRENYEAB-CSKARUKUSA-N. The full InChI is InChI=1S/C18H20N2O3S/c1-13-19-12-15(24-13)8-10-17(21)20-16(9-11-18(22)23-2)14-6-4-3-5-7-14/h3-8,10,12,16H,9,11H2,1-2H3,(H,20,21)/b10-8+.
What are the key properties of methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate?
methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate has a molecular weight of 344.44 g/mol, XLogP of 3.28, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-4-phenylbutanoate is sourced from PubChem (CID 75407267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).