C17H20N2O3S — CID 75533193
(E)-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enamide (PubChem CID 75533193) has the molecular formula C17H20N2O3S and a molecular weight of 332.43 g/mol. Its IUPAC name is (E)-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 75533193 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (E)-N-[2-(2,5-dimethoxyphenyl)ethyl]-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enamide |
| SMILES | COc1ccc(OC)c(CCNC(=O)/C=C/c2cnc(C)s2)c1 |
| InChI | InChI=1S/C17H20N2O3S/c1-12-19-11-15(23-12)5-7-17(20)18-9-8-13-10-14(21-2)4-6-16(13)22-3/h4-7,10-11H,8-9H2,1-3H3,(H,18,20)/b7-5+ |
| InChIKey | HLZXLFHGTJAOCY-FNORWQNLSA-N |
| XLogP | 2.84 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|