C14H8ClF3N6O2 — CID 110208574
3-chloro-2-[(4-nitrophenyl)-(2H-tetrazol-5-yl)methyl]-5-(trifluoromethyl)pyridine (PubChem CID 110208574) has the molecular formula C14H8ClF3N6O2 and a molecular weight of 384.71 g/mol. Its IUPAC name is 3-chloro-2-[(4-nitrophenyl)-(2H-tetrazol-5-yl)methyl]-5-(trifluoromethyl)pyridine.
| Compound Name | 3-chloro-2-[(4-nitrophenyl)-(2H-tetrazol-5-yl)methyl]-5-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 110208574 |
| Molecular Formula | C14H8ClF3N6O2 |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 3-chloro-2-[(4-nitrophenyl)-(2H-tetrazol-5-yl)methyl]-5-(trifluoromethyl)pyridine |
| SMILES | O=[N+]([O-])c1ccc(C(c2nn[nH]n2)c2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C14H8ClF3N6O2/c15-10-5-8(14(16,17)18)6-19-12(10)11(13-20-22-23-21-13)7-1-3-9(4-2-7)24(25)26/h1-6,11H,(H,20,21,22,23) |
| InChIKey | PMEWIDAEHXPRJC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|