C14H15NO2 — CID 82128384
3-methyl-5-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbaldehyde (PubChem CID 82128384) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-methyl-5-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbaldehyde.
| Compound Name | 3-methyl-5-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82128384 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-methyl-5-(4-propan-2-ylphenyl)-1,2-oxazole-4-carbaldehyde |
| SMILES | Cc1noc(-c2ccc(C(C)C)cc2)c1C=O |
| InChI | InChI=1S/C14H15NO2/c1-9(2)11-4-6-12(7-5-11)14-13(8-16)10(3)15-17-14/h4-9H,1-3H3 |
| InChIKey | IJMXMSBFMIGCFX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|